1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride

C20H30Cl2N2O2-2 — CID 45108743

IUPAC1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride
SMILESO=C(OC(CN1CCCCC1)CN1CCCCC1)c1ccccc1.[Cl-].[Cl-]
InChIInChI=1S/C20H30N2O2.2ClH/c23-20(18-10-4-1-5-11-18)24-19(16-21-12-6-2-7-13-21)17-22-14-8-3-9-15-22;;/h1,4-5,10-11,19H,2-3,6-9,12-17H2;2*1H/p-2
InChIKeyARYIKORYBPHWJB-UHFFFAOYSA-L
MW401.38 g/mol
LogP-2.81
Rot. Bonds6

About 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride

1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride (PubChem CID 45108743) has the molecular formula C20H30Cl2N2O2-2 and a molecular weight of 401.38 g/mol. Its IUPAC name is 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride.

Molecular Properties

Compound Name1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride
PubChem CID45108743
Molecular FormulaC20H30Cl2N2O2-2
Molecular Weight401.38 g/mol
Exact Mass400.17
IUPAC Name1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride
SMILESO=C(OC(CN1CCCCC1)CN1CCCCC1)c1ccccc1.[Cl-].[Cl-]
InChIInChI=1S/C20H30N2O2.2ClH/c23-20(18-10-4-1-5-11-18)24-19(16-21-12-6-2-7-13-21)17-22-14-8-3-9-15-22;;/h1,4-5,10-11,19H,2-3,6-9,12-17H2;2*1H/p-2
InChIKeyARYIKORYBPHWJB-UHFFFAOYSA-L
XLogP-2.81
TPSA32.78 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500401.38
LogP ≤ 5-2.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride?
The IUPAC name of 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride (CID 45108743) is 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride.
What is the SMILES notation for 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride?
The canonical SMILES for 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride is O=C(OC(CN1CCCCC1)CN1CCCCC1)c1ccccc1.[Cl-].[Cl-].
What is the InChIKey of 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride?
The InChIKey is ARYIKORYBPHWJB-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H30N2O2.2ClH/c23-20(18-10-4-1-5-11-18)24-19(16-21-12-6-2-7-13-21)17-22-14-8-3-9-15-22;;/h1,4-5,10-11,19H,2-3,6-9,12-17H2;2*1H/p-2.
What are the key properties of 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride?
1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride has a molecular weight of 401.38 g/mol, XLogP of -2.81, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride is sourced from PubChem (CID 45108743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).