C20H30Cl2N2O2-2 — CID 45108743
1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride (PubChem CID 45108743) has the molecular formula C20H30Cl2N2O2-2 and a molecular weight of 401.38 g/mol. Its IUPAC name is 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride.
| Compound Name | 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride |
|---|---|
| PubChem CID | 45108743 |
| Molecular Formula | C20H30Cl2N2O2-2 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1,3-di(piperidin-1-yl)propan-2-yl benzoate dichloride |
| SMILES | O=C(OC(CN1CCCCC1)CN1CCCCC1)c1ccccc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C20H30N2O2.2ClH/c23-20(18-10-4-1-5-11-18)24-19(16-21-12-6-2-7-13-21)17-22-14-8-3-9-15-22;;/h1,4-5,10-11,19H,2-3,6-9,12-17H2;2*1H/p-2 |
| InChIKey | ARYIKORYBPHWJB-UHFFFAOYSA-L |
| XLogP | -2.81 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |