C20H23NO2 — CID 177441507
[(1S)-1-phenyl-2-piperidin-1-ylethyl] benzoate (PubChem CID 177441507) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is [(1S)-1-phenyl-2-piperidin-1-ylethyl] benzoate.
| Compound Name | [(1S)-1-phenyl-2-piperidin-1-ylethyl] benzoate |
|---|---|
| PubChem CID | 177441507 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | [(1S)-1-phenyl-2-piperidin-1-ylethyl] benzoate |
| SMILES | O=C(O[C@H](CN1CCCCC1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c22-20(18-12-6-2-7-13-18)23-19(17-10-4-1-5-11-17)16-21-14-8-3-9-15-21/h1-2,4-7,10-13,19H,3,8-9,14-16H2/t19-/m1/s1 |
| InChIKey | ARFDWWNAZVZZBC-LJQANCHMSA-N |
| XLogP | 4.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |