C28H31NO3 — CID 7411313
[(1R,2R)-1-(4-methoxyphenyl)-2-phenyl-3-piperidin-1-ylpropyl] benzoate (PubChem CID 7411313) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is [(1R,2R)-1-(4-methoxyphenyl)-2-phenyl-3-piperidin-1-ylpropyl] benzoate.
| Compound Name | [(1R,2R)-1-(4-methoxyphenyl)-2-phenyl-3-piperidin-1-ylpropyl] benzoate |
|---|---|
| PubChem CID | 7411313 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | [(1R,2R)-1-(4-methoxyphenyl)-2-phenyl-3-piperidin-1-ylpropyl] benzoate |
| SMILES | COc1ccc([C@H](OC(=O)c2ccccc2)[C@@H](CN2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H31NO3/c1-31-25-17-15-23(16-18-25)27(32-28(30)24-13-7-3-8-14-24)26(22-11-5-2-6-12-22)21-29-19-9-4-10-20-29/h2-3,5-8,11-18,26-27H,4,9-10,19-21H2,1H3/t26-,27-/m0/s1 |
| InChIKey | QMRXCZLRIJZFBK-SVBPBHIXSA-N |
| XLogP | 5.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |