About [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate
[(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate (PubChem CID 848692) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate.
Molecular Properties
| Compound Name | [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate |
| PubChem CID | 848692 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H](C)CN2CCCC2)cc1 |
| InChI | InChI=1S/C15H21NO3/c1-12(11-16-9-3-4-10-16)19-15(17)13-5-7-14(18-2)8-6-13/h5-8,12H,3-4,9-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | FHILPKJQDVQFTR-GFCCVEGCSA-N |
| XLogP | 2.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate?
The IUPAC name of [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate (CID 848692) is [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate.
What is the SMILES notation for [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate?
The canonical SMILES for [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate is COc1ccc(C(=O)O[C@H](C)CN2CCCC2)cc1.
What is the InChIKey of [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate?
The InChIKey is FHILPKJQDVQFTR-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H21NO3/c1-12(11-16-9-3-4-10-16)19-15(17)13-5-7-14(18-2)8-6-13/h5-8,12H,3-4,9-11H2,1-2H3/t12-/m1/s1.
What are the key properties of [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate?
[(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate has a molecular weight of 263.34 g/mol, XLogP of 2.34, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-pyrrolidin-1-ylpropan-2-yl] 4-methoxybenzoate is sourced from PubChem (CID 848692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).