About 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride
1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride (PubChem CID 53352536) has the molecular formula C15H21ClNO4-
and a molecular weight of 314.79 g/mol. Its IUPAC name is 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride.
Molecular Properties
| Compound Name | 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride |
| PubChem CID | 53352536 |
| Molecular Formula | C15H21ClNO4- |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride |
| SMILES | COc1ccc(C(=O)OC(C)CN2CCOCC2)cc1.[Cl-] |
| InChI | InChI=1S/C15H21NO4.ClH/c1-12(11-16-7-9-19-10-8-16)20-15(17)13-3-5-14(18-2)6-4-13;/h3-6,12H,7-11H2,1-2H3;1H/p-1 |
| InChIKey | VZAOMCBDKKDNJI-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride?
The IUPAC name of 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride (CID 53352536) is 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride.
What is the SMILES notation for 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride?
The canonical SMILES for 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride is COc1ccc(C(=O)OC(C)CN2CCOCC2)cc1.[Cl-].
What is the InChIKey of 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride?
The InChIKey is VZAOMCBDKKDNJI-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H21NO4.ClH/c1-12(11-16-7-9-19-10-8-16)20-15(17)13-3-5-14(18-2)6-4-13;/h3-6,12H,7-11H2,1-2H3;1H/p-1.
What are the key properties of 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride?
1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride has a molecular weight of 314.79 g/mol, XLogP of -1.42, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylpropan-2-yl 4-methoxybenzoate chloride is sourced from PubChem (CID 53352536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).