About 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride
1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride (PubChem CID 53347672) has the molecular formula C15H21ClNO3-
and a molecular weight of 298.79 g/mol. Its IUPAC name is 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride.
Molecular Properties
| Compound Name | 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride |
| PubChem CID | 53347672 |
| Molecular Formula | C15H21ClNO3- |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride |
| SMILES | Cc1ccccc1C(=O)OC(C)CN1CCOCC1.[Cl-] |
| InChI | InChI=1S/C15H21NO3.ClH/c1-12-5-3-4-6-14(12)15(17)19-13(2)11-16-7-9-18-10-8-16;/h3-6,13H,7-11H2,1-2H3;1H/p-1 |
| InChIKey | GLTWYDXWZCAXHD-UHFFFAOYSA-M |
| XLogP | -1.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride?
The IUPAC name of 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride (CID 53347672) is 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride.
What is the SMILES notation for 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride?
The canonical SMILES for 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride is Cc1ccccc1C(=O)OC(C)CN1CCOCC1.[Cl-].
What is the InChIKey of 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride?
The InChIKey is GLTWYDXWZCAXHD-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H21NO3.ClH/c1-12-5-3-4-6-14(12)15(17)19-13(2)11-16-7-9-18-10-8-16;/h3-6,13H,7-11H2,1-2H3;1H/p-1.
What are the key properties of 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride?
1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride has a molecular weight of 298.79 g/mol, XLogP of -1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylpropan-2-yl 2-methylbenzoate chloride is sourced from PubChem (CID 53347672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).