About [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate
[(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate (PubChem CID 755745) has the molecular formula C14H18ClNO2
and a molecular weight of 267.76 g/mol. Its IUPAC name is [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate.
Molecular Properties
| Compound Name | [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate |
| PubChem CID | 755745 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate |
| SMILES | C[C@@H](CN1CCCC1)OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C14H18ClNO2/c1-11(10-16-8-4-5-9-16)18-14(17)12-6-2-3-7-13(12)15/h2-3,6-7,11H,4-5,8-10H2,1H3/t11-/m0/s1 |
| InChIKey | BJRDJWSBYLPXMR-NSHDSACASA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate?
The IUPAC name of [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate (CID 755745) is [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate.
What is the SMILES notation for [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate?
The canonical SMILES for [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate is C[C@@H](CN1CCCC1)OC(=O)c1ccccc1Cl.
What is the InChIKey of [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate?
The InChIKey is BJRDJWSBYLPXMR-NSHDSACASA-N. The full InChI is InChI=1S/C14H18ClNO2/c1-11(10-16-8-4-5-9-16)18-14(17)12-6-2-3-7-13(12)15/h2-3,6-7,11H,4-5,8-10H2,1H3/t11-/m0/s1.
What are the key properties of [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate?
[(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate has a molecular weight of 267.76 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 2-chlorobenzoate is sourced from PubChem (CID 755745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).