C16H24ClNO3 — CID 52998166
1-piperidin-1-ylpropan-2-yl 2-methoxybenzoate;hydrochloride (PubChem CID 52998166) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is 1-piperidin-1-ylpropan-2-yl 2-methoxybenzoate;hydrochloride.
| Compound Name | 1-piperidin-1-ylpropan-2-yl 2-methoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 52998166 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-piperidin-1-ylpropan-2-yl 2-methoxybenzoate;hydrochloride |
| SMILES | COc1ccccc1C(=O)OC(C)CN1CCCCC1.Cl |
| InChI | InChI=1S/C16H23NO3.ClH/c1-13(12-17-10-6-3-7-11-17)20-16(18)14-8-4-5-9-15(14)19-2;/h4-5,8-9,13H,3,6-7,10-12H2,1-2H3;1H |
| InChIKey | DUWONFAUWZSEQF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |