C16H24NO3+ — CID 3595856
1-piperidin-1-ium-1-ylpropan-2-yl 2-methoxybenzoate (PubChem CID 3595856) has the molecular formula C16H24NO3+ and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-piperidin-1-ium-1-ylpropan-2-yl 2-methoxybenzoate.
| Compound Name | 1-piperidin-1-ium-1-ylpropan-2-yl 2-methoxybenzoate |
|---|---|
| PubChem CID | 3595856 |
| Molecular Formula | C16H24NO3+ |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-piperidin-1-ium-1-ylpropan-2-yl 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OC(C)C[NH+]1CCCCC1 |
| InChI | InChI=1S/C16H23NO3/c1-13(12-17-10-6-3-7-11-17)20-16(18)14-8-4-5-9-15(14)19-2/h4-5,8-9,13H,3,6-7,10-12H2,1-2H3/p+1 |
| InChIKey | AISGESNXKYSJCM-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |