C16H24NO2+ — CID 7279504
[(2R)-1-piperidin-1-ium-1-ylpropan-2-yl] 3-methylbenzoate (PubChem CID 7279504) has the molecular formula C16H24NO2+ and a molecular weight of 262.37 g/mol. Its IUPAC name is [(2R)-1-piperidin-1-ium-1-ylpropan-2-yl] 3-methylbenzoate.
| Compound Name | [(2R)-1-piperidin-1-ium-1-ylpropan-2-yl] 3-methylbenzoate |
|---|---|
| PubChem CID | 7279504 |
| Molecular Formula | C16H24NO2+ |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | [(2R)-1-piperidin-1-ium-1-ylpropan-2-yl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)O[C@H](C)C[NH+]2CCCCC2)c1 |
| InChI | InChI=1S/C16H23NO2/c1-13-7-6-8-15(11-13)16(18)19-14(2)12-17-9-4-3-5-10-17/h6-8,11,14H,3-5,9-10,12H2,1-2H3/p+1/t14-/m1/s1 |
| InChIKey | IMINSZZAJSJCJP-CQSZACIVSA-O |
| XLogP | 1.61 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |