C15H23ClN2O2+2 — CID 6937720
[(2R)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] 3-chlorobenzoate (PubChem CID 6937720) has the molecular formula C15H23ClN2O2+2 and a molecular weight of 298.81 g/mol. Its IUPAC name is [(2R)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] 3-chlorobenzoate.
| Compound Name | [(2R)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 6937720 |
| Molecular Formula | C15H23ClN2O2+2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [(2R)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] 3-chlorobenzoate |
| SMILES | C[C@H](C[NH+]1CC[NH+](C)CC1)OC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O2/c1-12(11-18-8-6-17(2)7-9-18)20-15(19)13-4-3-5-14(16)10-13/h3-5,10,12H,6-9,11H2,1-2H3/p+2/t12-/m1/s1 |
| InChIKey | UZLNBSGDRJOASM-GFCCVEGCSA-P |
| XLogP | -0.70 |
| TPSA | 35.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |