About 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate
1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate (PubChem CID 3152962) has the molecular formula C15H21ClN2O2
and a molecular weight of 296.80 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate.
Molecular Properties
| Compound Name | 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate |
| PubChem CID | 3152962 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate |
| SMILES | CC(CN1CCN(C)CC1)OC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O2/c1-12(11-18-8-6-17(2)7-9-18)20-15(19)13-4-3-5-14(16)10-13/h3-5,10,12H,6-9,11H2,1-2H3 |
| InChIKey | UZLNBSGDRJOASM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate?
The IUPAC name of 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate (CID 3152962) is 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate.
What is the SMILES notation for 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate?
The canonical SMILES for 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate is CC(CN1CCN(C)CC1)OC(=O)c1cccc(Cl)c1.
What is the InChIKey of 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate?
The InChIKey is UZLNBSGDRJOASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClN2O2/c1-12(11-18-8-6-17(2)7-9-18)20-15(19)13-4-3-5-14(16)10-13/h3-5,10,12H,6-9,11H2,1-2H3.
What are the key properties of 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate?
1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate has a molecular weight of 296.80 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylpiperazin-1-yl)propan-2-yl 3-chlorobenzoate is sourced from PubChem (CID 3152962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).