About [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate
[(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate (PubChem CID 755779) has the molecular formula C15H21FN2O2
and a molecular weight of 280.34 g/mol. Its IUPAC name is [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate.
Molecular Properties
| Compound Name | [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate |
| PubChem CID | 755779 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate |
| SMILES | C[C@@H](CN1CCN(C)CC1)OC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C15H21FN2O2/c1-12(11-18-8-6-17(2)7-9-18)20-15(19)13-4-3-5-14(16)10-13/h3-5,10,12H,6-9,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | ODMNRTFCRVSWLT-LBPRGKRZSA-N |
| XLogP | 1.62 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate?
The IUPAC name of [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate (CID 755779) is [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate.
What is the SMILES notation for [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate?
The canonical SMILES for [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate is C[C@@H](CN1CCN(C)CC1)OC(=O)c1cccc(F)c1.
What is the InChIKey of [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate?
The InChIKey is ODMNRTFCRVSWLT-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H21FN2O2/c1-12(11-18-8-6-17(2)7-9-18)20-15(19)13-4-3-5-14(16)10-13/h3-5,10,12H,6-9,11H2,1-2H3/t12-/m0/s1.
What are the key properties of [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate?
[(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate has a molecular weight of 280.34 g/mol, XLogP of 1.62, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 3-fluorobenzoate is sourced from PubChem (CID 755779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).