C17H26N2O3 — CID 937223
[(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 2-(3-methylphenoxy)acetate (PubChem CID 937223) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 2-(3-methylphenoxy)acetate.
| Compound Name | [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 2-(3-methylphenoxy)acetate |
|---|---|
| PubChem CID | 937223 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | [(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl] 2-(3-methylphenoxy)acetate |
| SMILES | Cc1cccc(OCC(=O)O[C@@H](C)CN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-14-5-4-6-16(11-14)21-13-17(20)22-15(2)12-19-9-7-18(3)8-10-19/h4-6,11,15H,7-10,12-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | UZUNAJOHNHFZCJ-HNNXBMFYSA-N |
| XLogP | 1.55 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |