C14H19ClNO2+ — CID 6937715
[(2S)-1-pyrrolidin-1-ium-1-ylpropan-2-yl] 2-chlorobenzoate (PubChem CID 6937715) has the molecular formula C14H19ClNO2+ and a molecular weight of 268.76 g/mol. Its IUPAC name is [(2S)-1-pyrrolidin-1-ium-1-ylpropan-2-yl] 2-chlorobenzoate.
| Compound Name | [(2S)-1-pyrrolidin-1-ium-1-ylpropan-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6937715 |
| Molecular Formula | C14H19ClNO2+ |
| Molecular Weight | 268.76 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [(2S)-1-pyrrolidin-1-ium-1-ylpropan-2-yl] 2-chlorobenzoate |
| SMILES | C[C@@H](C[NH+]1CCCC1)OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C14H18ClNO2/c1-11(10-16-8-4-5-9-16)18-14(17)12-6-2-3-7-13(12)15/h2-3,6-7,11H,4-5,8-10H2,1H3/p+1/t11-/m0/s1 |
| InChIKey | BJRDJWSBYLPXMR-NSHDSACASA-O |
| XLogP | 1.56 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.76 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |