About [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate
[(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate (PubChem CID 6949317) has the molecular formula C15H22NO4+
and a molecular weight of 280.34 g/mol. Its IUPAC name is [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate.
Molecular Properties
| Compound Name | [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate |
| PubChem CID | 6949317 |
| Molecular Formula | C15H22NO4+ |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)O[C@@H](C)C[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H21NO4/c1-12(11-16-7-9-19-10-8-16)20-15(17)13-5-3-4-6-14(13)18-2/h3-6,12H,7-11H2,1-2H3/p+1/t12-/m0/s1 |
| InChIKey | OLOYPVJKDWAERB-LBPRGKRZSA-O |
| XLogP | 0.16 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate?
The IUPAC name of [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate (CID 6949317) is [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate.
What is the SMILES notation for [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate?
The canonical SMILES for [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate is COc1ccccc1C(=O)O[C@@H](C)C[NH+]1CCOCC1.
What is the InChIKey of [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate?
The InChIKey is OLOYPVJKDWAERB-LBPRGKRZSA-O. The full InChI is InChI=1S/C15H21NO4/c1-12(11-16-7-9-19-10-8-16)20-15(17)13-5-3-4-6-14(13)18-2/h3-6,12H,7-11H2,1-2H3/p+1/t12-/m0/s1.
What are the key properties of [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate?
[(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate has a molecular weight of 280.34 g/mol, XLogP of 0.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-morpholin-4-ium-4-ylpropan-2-yl] 2-methoxybenzoate is sourced from PubChem (CID 6949317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).