About 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride
1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride (PubChem CID 44656541) has the molecular formula C16H24ClNO4
and a molecular weight of 329.82 g/mol. Its IUPAC name is 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride.
Molecular Properties
| Compound Name | 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride |
| PubChem CID | 44656541 |
| Molecular Formula | C16H24ClNO4 |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride |
| SMILES | CCOc1ccc(C(=O)OC(C)C[NH+]2CCOCC2)cc1.[Cl-] |
| InChI | InChI=1S/C16H23NO4.ClH/c1-3-20-15-6-4-14(5-7-15)16(18)21-13(2)12-17-8-10-19-11-9-17;/h4-7,13H,3,8-12H2,1-2H3;1H |
| InChIKey | YVFJLTNUJRNNSY-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride?
The IUPAC name of 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride (CID 44656541) is 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride.
What is the SMILES notation for 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride?
The canonical SMILES for 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride is CCOc1ccc(C(=O)OC(C)C[NH+]2CCOCC2)cc1.[Cl-].
What is the InChIKey of 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride?
The InChIKey is YVFJLTNUJRNNSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO4.ClH/c1-3-20-15-6-4-14(5-7-15)16(18)21-13(2)12-17-8-10-19-11-9-17;/h4-7,13H,3,8-12H2,1-2H3;1H.
What are the key properties of 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride?
1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride has a molecular weight of 329.82 g/mol, XLogP of -2.45, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ium-4-ylpropan-2-yl 4-ethoxybenzoate chloride is sourced from PubChem (CID 44656541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).