C15H24N2O2+2 — CID 6949803
[(2S)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] benzoate (PubChem CID 6949803) has the molecular formula C15H24N2O2+2 and a molecular weight of 264.37 g/mol. Its IUPAC name is [(2S)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] benzoate.
| Compound Name | [(2S)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] benzoate |
|---|---|
| PubChem CID | 6949803 |
| Molecular Formula | C15H24N2O2+2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | [(2S)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] benzoate |
| SMILES | C[C@@H](C[NH+]1CC[NH+](C)CC1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22N2O2/c1-13(12-17-10-8-16(2)9-11-17)19-15(18)14-6-4-3-5-7-14/h3-7,13H,8-12H2,1-2H3/p+2/t13-/m0/s1 |
| InChIKey | RDIGRIHLBCLZPD-ZDUSSCGKSA-P |
| XLogP | -1.35 |
| TPSA | 35.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |