C22H28NO2+ — CID 4683134
1-piperidin-1-ium-1-ylpropan-2-yl 2,2-diphenylacetate (PubChem CID 4683134) has the molecular formula C22H28NO2+ and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-piperidin-1-ium-1-ylpropan-2-yl 2,2-diphenylacetate.
| Compound Name | 1-piperidin-1-ium-1-ylpropan-2-yl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 4683134 |
| Molecular Formula | C22H28NO2+ |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-piperidin-1-ium-1-ylpropan-2-yl 2,2-diphenylacetate |
| SMILES | CC(C[NH+]1CCCCC1)OC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO2/c1-18(17-23-15-9-4-10-16-23)25-22(24)21(19-11-5-2-6-12-19)20-13-7-3-8-14-20/h2-3,5-8,11-14,18,21H,4,9-10,15-17H2,1H3/p+1 |
| InChIKey | IZESOZHYTXOOBW-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |