C20H26NO2+ — CID 846538
[(2R)-2-(2,2-diphenylacetyl)oxypropyl]-trimethylazanium (PubChem CID 846538) has the molecular formula C20H26NO2+ and a molecular weight of 312.43 g/mol. Its IUPAC name is [(2R)-2-(2,2-diphenylacetyl)oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-2-(2,2-diphenylacetyl)oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 846538 |
| Molecular Formula | C20H26NO2+ |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [(2R)-2-(2,2-diphenylacetyl)oxypropyl]-trimethylazanium |
| SMILES | C[C@H](C[N+](C)(C)C)OC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26NO2/c1-16(15-21(2,3)4)23-20(22)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,19H,15H2,1-4H3/q+1/t16-/m1/s1 |
| InChIKey | FMQQCVOCWNPYPL-MRXNPFEDSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|