C18H28INO2 — CID 44660686
trimethyl-[2-(1-phenylcyclopentanecarbonyl)oxypropyl]azanium iodide (PubChem CID 44660686) has the molecular formula C18H28INO2 and a molecular weight of 417.33 g/mol. Its IUPAC name is trimethyl-[2-(1-phenylcyclopentanecarbonyl)oxypropyl]azanium iodide.
| Compound Name | trimethyl-[2-(1-phenylcyclopentanecarbonyl)oxypropyl]azanium iodide |
|---|---|
| PubChem CID | 44660686 |
| Molecular Formula | C18H28INO2 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | trimethyl-[2-(1-phenylcyclopentanecarbonyl)oxypropyl]azanium iodide |
| SMILES | CC(C[N+](C)(C)C)OC(=O)C1(c2ccccc2)CCCC1.[I-] |
| InChI | InChI=1S/C18H28NO2.HI/c1-15(14-19(2,3)4)21-17(20)18(12-8-9-13-18)16-10-6-5-7-11-16;/h5-7,10-11,15H,8-9,12-14H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ZNVKXARBRKHDHG-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|