C21H31NO2 — CID 71244251
[(1R)-1-piperidin-4-ylethyl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 71244251) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is [(1R)-1-piperidin-4-ylethyl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | [(1R)-1-piperidin-4-ylethyl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 71244251 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | [(1R)-1-piperidin-4-ylethyl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | C[C@@H](OC(=O)C1(c2ccccc2)CCCCCC1)C1CCNCC1 |
| InChI | InChI=1S/C21H31NO2/c1-17(18-11-15-22-16-12-18)24-20(23)21(13-7-2-3-8-14-21)19-9-5-4-6-10-19/h4-6,9-10,17-18,22H,2-3,7-8,11-16H2,1H3/t17-/m1/s1 |
| InChIKey | HAYSZPFFEDAIRJ-QGZVFWFLSA-N |
| XLogP | 4.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |