C20H30INO2 — CID 24987734
[(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 1-phenylcycloheptane-1-carboxylate iodide (PubChem CID 24987734) has the molecular formula C20H30INO2 and a molecular weight of 443.37 g/mol. Its IUPAC name is [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 1-phenylcycloheptane-1-carboxylate iodide.
| Compound Name | [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 1-phenylcycloheptane-1-carboxylate iodide |
|---|---|
| PubChem CID | 24987734 |
| Molecular Formula | C20H30INO2 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 1-phenylcycloheptane-1-carboxylate iodide |
| SMILES | C[N+]1(C)CC[C@H](OC(=O)C2(c3ccccc3)CCCCCC2)C1.[I-] |
| InChI | InChI=1S/C20H30NO2.HI/c1-21(2)15-12-18(16-21)23-19(22)20(13-8-3-4-9-14-20)17-10-6-5-7-11-17;/h5-7,10-11,18H,3-4,8-9,12-16H2,1-2H3;1H/q+1;/p-1/t18-;/m0./s1 |
| InChIKey | RUUJNJSWELHCMP-FERBBOLQSA-M |
| XLogP | 0.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|