C30H39N2O3+ — CID 58348378
[(3R)-1-[2-(N-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 58348378) has the molecular formula C30H39N2O3+ and a molecular weight of 475.65 g/mol. Its IUPAC name is [(3R)-1-[2-(N-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | [(3R)-1-[2-(N-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 58348378 |
| Molecular Formula | C30H39N2O3+ |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | [(3R)-1-[2-(N-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | CN(C(=O)C[N+]12CCC(CC1)[C@@H](OC(=O)C1(c3ccccc3)CCCCCC1)C2)c1ccccc1 |
| InChI | InChI=1S/C30H39N2O3/c1-31(26-14-8-5-9-15-26)28(33)23-32-20-16-24(17-21-32)27(22-32)35-29(34)30(18-10-2-3-11-19-30)25-12-6-4-7-13-25/h4-9,12-15,24,27H,2-3,10-11,16-23H2,1H3/q+1/t24?,27-,32?/m0/s1 |
| InChIKey | HWWZLRTUULTFKE-KRXIBUGQSA-N |
| XLogP | 5.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|