C30H39N2O3+ — CID 87351404
[1-[2-(2-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 87351404) has the molecular formula C30H39N2O3+ and a molecular weight of 475.65 g/mol. Its IUPAC name is [1-[2-(2-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | [1-[2-(2-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 87351404 |
| Molecular Formula | C30H39N2O3+ |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | [1-[2-(2-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | Cc1ccccc1NC(=O)C[N+]12CCC(CC1)C(OC(=O)C1(c3ccccc3)CCCCCC1)C2 |
| InChI | InChI=1S/C30H38N2O3/c1-23-11-7-8-14-26(23)31-28(33)22-32-19-15-24(16-20-32)27(21-32)35-29(34)30(17-9-2-3-10-18-30)25-12-5-4-6-13-25/h4-8,11-14,24,27H,2-3,9-10,15-22H2,1H3/p+1 |
| InChIKey | JQMACVFBFUCENQ-UHFFFAOYSA-O |
| XLogP | 5.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|