C30H39BrN2O3 — CID 87351401
[(3R)-1-[2-(2-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide (PubChem CID 87351401) has the molecular formula C30H39BrN2O3 and a molecular weight of 555.56 g/mol. Its IUPAC name is [(3R)-1-[2-(2-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide.
| Compound Name | [(3R)-1-[2-(2-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide |
|---|---|
| PubChem CID | 87351401 |
| Molecular Formula | C30H39BrN2O3 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | [(3R)-1-[2-(2-methylanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide |
| SMILES | Cc1ccccc1NC(=O)C[N+]12CCC(CC1)[C@@H](OC(=O)C1(c3ccccc3)CCCCCC1)C2.[Br-] |
| InChI | InChI=1S/C30H38N2O3.BrH/c1-23-11-7-8-14-26(23)31-28(33)22-32-19-15-24(16-20-32)27(21-32)35-29(34)30(17-9-2-3-10-18-30)25-12-5-4-6-13-25;/h4-8,11-14,24,27H,2-3,9-10,15-22H2,1H3;1H/t24?,27-,32?;/m0./s1 |
| InChIKey | FXVQCJVHWVZEMS-GLSBDXMNSA-N |
| XLogP | 2.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|