C28H37N2O4+ — CID 159200812
[(3R)-1-[3-(3-methyl-1,2-oxazol-5-yl)-2-oxopropyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 159200812) has the molecular formula C28H37N2O4+ and a molecular weight of 465.61 g/mol. Its IUPAC name is [(3R)-1-[3-(3-methyl-1,2-oxazol-5-yl)-2-oxopropyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | [(3R)-1-[3-(3-methyl-1,2-oxazol-5-yl)-2-oxopropyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 159200812 |
| Molecular Formula | C28H37N2O4+ |
| Molecular Weight | 465.61 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | [(3R)-1-[3-(3-methyl-1,2-oxazol-5-yl)-2-oxopropyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | Cc1cc(CC(=O)C[N+]23CCC(CC2)[C@@H](OC(=O)C2(c4ccccc4)CCCCCC2)C3)on1 |
| InChI | InChI=1S/C28H37N2O4/c1-21-17-25(34-29-21)18-24(31)19-30-15-11-22(12-16-30)26(20-30)33-27(32)28(13-7-2-3-8-14-28)23-9-5-4-6-10-23/h4-6,9-10,17,22,26H,2-3,7-8,11-16,18-20H2,1H3/q+1/t22?,26-,30?/m0/s1 |
| InChIKey | KPGMSRVGSUMSID-VOHYGNEJSA-N |
| XLogP | 4.54 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|