C32H43N2O3+ — CID 24991097
[(3R)-1-[2-oxo-2-(3-phenylpropylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 24991097) has the molecular formula C32H43N2O3+ and a molecular weight of 503.71 g/mol. Its IUPAC name is [(3R)-1-[2-oxo-2-(3-phenylpropylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | [(3R)-1-[2-oxo-2-(3-phenylpropylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 24991097 |
| Molecular Formula | C32H43N2O3+ |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.33 |
| IUPAC Name | [(3R)-1-[2-oxo-2-(3-phenylpropylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C1(c3ccccc3)CCCCCC1)C2)NCCCc1ccccc1 |
| InChI | InChI=1S/C32H42N2O3/c35-30(33-21-11-14-26-12-5-3-6-13-26)25-34-22-17-27(18-23-34)29(24-34)37-31(36)32(19-9-1-2-10-20-32)28-15-7-4-8-16-28/h3-8,12-13,15-16,27,29H,1-2,9-11,14,17-25H2/p+1/t27?,29-,34?/m0/s1 |
| InChIKey | HBVYYPABZRTBLD-ZGBRQYORSA-O |
| XLogP | 5.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|