C28H37BrN4O3 — CID 67310398
[(3R)-1-[2-(pyrazine-2-carbonylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide (PubChem CID 67310398) has the molecular formula C28H37BrN4O3 and a molecular weight of 557.53 g/mol. Its IUPAC name is [(3R)-1-[2-(pyrazine-2-carbonylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide.
| Compound Name | [(3R)-1-[2-(pyrazine-2-carbonylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide |
|---|---|
| PubChem CID | 67310398 |
| Molecular Formula | C28H37BrN4O3 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | [(3R)-1-[2-(pyrazine-2-carbonylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide |
| SMILES | O=C(NCC[N+]12CCC(CC1)[C@@H](OC(=O)C1(c3ccccc3)CCCCCC1)C2)c1cnccn1.[Br-] |
| InChI | InChI=1S/C28H36N4O3.BrH/c33-26(24-20-29-14-15-30-24)31-16-19-32-17-10-22(11-18-32)25(21-32)35-27(34)28(12-6-1-2-7-13-28)23-8-4-3-5-9-23;/h3-5,8-9,14-15,20,22,25H,1-2,6-7,10-13,16-19,21H2;1H/t22?,25-,32?;/m0./s1 |
| InChIKey | SFSUDDXWAZYHII-ZJKFLMFHSA-N |
| XLogP | 0.65 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|