C27H35ClN4O3 — CID 142790649
[(3R)-1-(2-amino-2-oxo-1-pyrimidin-5-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate chloride (PubChem CID 142790649) has the molecular formula C27H35ClN4O3 and a molecular weight of 499.06 g/mol. Its IUPAC name is [(3R)-1-(2-amino-2-oxo-1-pyrimidin-5-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate chloride.
| Compound Name | [(3R)-1-(2-amino-2-oxo-1-pyrimidin-5-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate chloride |
|---|---|
| PubChem CID | 142790649 |
| Molecular Formula | C27H35ClN4O3 |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [(3R)-1-(2-amino-2-oxo-1-pyrimidin-5-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate chloride |
| SMILES | NC(=O)C(c1cncnc1)[N+]12CCC(CC1)[C@@H](OC(=O)C1(c3ccccc3)CCCCCC1)C2.[Cl-] |
| InChI | InChI=1S/C27H34N4O3.ClH/c28-25(32)24(21-16-29-19-30-17-21)31-14-10-20(11-15-31)23(18-31)34-26(33)27(12-6-1-2-7-13-27)22-8-4-3-5-9-22;/h3-5,8-9,16-17,19-20,23-24H,1-2,6-7,10-15,18H2,(H-,28,32);1H/t20?,23-,24?,31?;/m0./s1 |
| InChIKey | DPAJXNORBXPMJC-JCMATTMFSA-N |
| XLogP | 0.45 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|