C31H38ClN3O2 — CID 87650421
[(3R)-1-[phenyl(4H-pyrazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate chloride (PubChem CID 87650421) has the molecular formula C31H38ClN3O2 and a molecular weight of 520.12 g/mol. Its IUPAC name is [(3R)-1-[phenyl(4H-pyrazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate chloride.
| Compound Name | [(3R)-1-[phenyl(4H-pyrazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate chloride |
|---|---|
| PubChem CID | 87650421 |
| Molecular Formula | C31H38ClN3O2 |
| Molecular Weight | 520.12 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | [(3R)-1-[phenyl(4H-pyrazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate chloride |
| SMILES | O=C(O[C@H]1C[N+]2(C(C3=NN=CC3)c3ccccc3)CCC1CC2)C1(c2ccccc2)CCCCCC1.[Cl-] |
| InChI | InChI=1S/C31H38N3O2.ClH/c35-30(31(18-9-1-2-10-19-31)26-13-7-4-8-14-26)36-28-23-34(21-16-24(28)17-22-34)29(27-15-20-32-33-27)25-11-5-3-6-12-25;/h3-8,11-14,20,24,28-29H,1-2,9-10,15-19,21-23H2;1H/q+1;/p-1/t24?,28-,29?,34?;/m0./s1 |
| InChIKey | FNFMWQMHSNLZLB-UCAIFWFFSA-M |
| XLogP | 3.01 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|