C31H39BrN2O3 — CID 67310760
[1-[3-(4-cyanophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide (PubChem CID 67310760) has the molecular formula C31H39BrN2O3 and a molecular weight of 567.57 g/mol. Its IUPAC name is [1-[3-(4-cyanophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide.
| Compound Name | [1-[3-(4-cyanophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide |
|---|---|
| PubChem CID | 67310760 |
| Molecular Formula | C31H39BrN2O3 |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | [1-[3-(4-cyanophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate bromide |
| SMILES | N#Cc1ccc(OCCC[N+]23CCC(CC2)C(OC(=O)C2(c4ccccc4)CCCCCC2)C3)cc1.[Br-] |
| InChI | InChI=1S/C31H39N2O3.BrH/c32-23-25-11-13-28(14-12-25)35-22-8-19-33-20-15-26(16-21-33)29(24-33)36-30(34)31(17-6-1-2-7-18-31)27-9-4-3-5-10-27;/h3-5,9-14,26,29H,1-2,6-8,15-22,24H2;1H/q+1;/p-1 |
| InChIKey | CCOJOGIDLVWRJG-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|