C17H25NO4P+ — CID 66827995
[1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] phosphanyl carbonate (PubChem CID 66827995) has the molecular formula C17H25NO4P+ and a molecular weight of 338.36 g/mol. Its IUPAC name is [1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] phosphanyl carbonate.
| Compound Name | [1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] phosphanyl carbonate |
|---|---|
| PubChem CID | 66827995 |
| Molecular Formula | C17H25NO4P+ |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] phosphanyl carbonate |
| SMILES | O=C(OP)OC1C[N+]2(CCCOc3ccccc3)CCC1CC2 |
| InChI | InChI=1S/C17H25NO4P/c19-17(22-23)21-16-13-18(10-7-14(16)8-11-18)9-4-12-20-15-5-2-1-3-6-15/h1-3,5-6,14,16H,4,7-13,23H2/q+1 |
| InChIKey | YNHQDOROTBJRNP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|