C24H31N2O3+ — CID 46841523
[(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-amino-3-phenylpropanoate (PubChem CID 46841523) has the molecular formula C24H31N2O3+ and a molecular weight of 395.52 g/mol. Its IUPAC name is [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-amino-3-phenylpropanoate.
| Compound Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 46841523 |
| Molecular Formula | C24H31N2O3+ |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-amino-3-phenylpropanoate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O[C@H]1C[N+]2(CCOc3ccccc3)CCC1CC2 |
| InChI | InChI=1S/C24H31N2O3/c25-22(17-19-7-3-1-4-8-19)24(27)29-23-18-26(13-11-20(23)12-14-26)15-16-28-21-9-5-2-6-10-21/h1-10,20,22-23H,11-18,25H2/q+1/t20?,22-,23-,26?/m0/s1 |
| InChIKey | WYQDLCADEAOGGX-BZYPPAADSA-N |
| XLogP | 2.79 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|