C32H35F3N2O5 — CID 10210443
[(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-phenyl-N-(2-phenylethyl)carbamate;2,2,2-trifluoroacetate (PubChem CID 10210443) has the molecular formula C32H35F3N2O5 and a molecular weight of 584.64 g/mol. Its IUPAC name is [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-phenyl-N-(2-phenylethyl)carbamate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-phenyl-N-(2-phenylethyl)carbamate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10210443 |
| Molecular Formula | C32H35F3N2O5 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-phenyl-N-(2-phenylethyl)carbamate;2,2,2-trifluoroacetate |
| SMILES | O=C(O[C@H]1C[N+]2(CCOc3ccccc3)CCC1CC2)N(CCc1ccccc1)c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C30H35N2O3.C2HF3O2/c33-30(31(27-12-6-2-7-13-27)19-16-25-10-4-1-5-11-25)35-29-24-32(20-17-26(29)18-21-32)22-23-34-28-14-8-3-9-15-28;3-2(4,5)1(6)7/h1-15,26,29H,16-24H2;(H,6,7)/q+1;/p-1/t26?,29-,32?;/m0./s1 |
| InChIKey | PAZJAFKVOUZUPG-RARKWRLQSA-M |
| XLogP | 4.86 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|