C26H31F3N2O5 — CID 90396688
[(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-(2-aminophenyl)propanoate;2,2,2-trifluoroacetate (PubChem CID 90396688) has the molecular formula C26H31F3N2O5 and a molecular weight of 508.54 g/mol. Its IUPAC name is [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-(2-aminophenyl)propanoate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-(2-aminophenyl)propanoate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 90396688 |
| Molecular Formula | C26H31F3N2O5 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-(2-aminophenyl)propanoate;2,2,2-trifluoroacetate |
| SMILES | Nc1ccccc1CCC(=O)O[C@H]1C[N+]2(CCOc3ccccc3)CCC1CC2.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H31N2O3.C2HF3O2/c25-22-9-5-4-6-19(22)10-11-24(27)29-23-18-26(14-12-20(23)13-15-26)16-17-28-21-7-2-1-3-8-21;3-2(4,5)1(6)7/h1-9,20,23H,10-18,25H2;(H,6,7)/q+1;/p-1/t20?,23-,26?;/m0./s1 |
| InChIKey | NYWBCYSEMHUJSL-KYXGRURGSA-M |
| XLogP | 2.73 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|