C29H31BrINO4 — CID 158399392
[1-[2-(3-iodophenoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide (PubChem CID 158399392) has the molecular formula C29H31BrINO4 and a molecular weight of 664.38 g/mol. Its IUPAC name is [1-[2-(3-iodophenoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide.
| Compound Name | [1-[2-(3-iodophenoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
|---|---|
| PubChem CID | 158399392 |
| Molecular Formula | C29H31BrINO4 |
| Molecular Weight | 664.38 g/mol |
| Exact Mass | 663.05 |
| IUPAC Name | [1-[2-(3-iodophenoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
| SMILES | O=C(OC1C[N+]2(CCOc3cccc(I)c3)CCC1CC2)C(O)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C29H31INO4.BrH/c30-25-12-7-13-26(20-25)34-19-18-31-16-14-22(15-17-31)27(21-31)35-28(32)29(33,23-8-3-1-4-9-23)24-10-5-2-6-11-24;/h1-13,20,22,27,33H,14-19,21H2;1H/q+1;/p-1 |
| InChIKey | LUKLPPCCMSLWHZ-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|