C30H33BrINO4 — CID 158141087
[1-[3-(4-iodophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide (PubChem CID 158141087) has the molecular formula C30H33BrINO4 and a molecular weight of 678.41 g/mol. Its IUPAC name is [1-[3-(4-iodophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide.
| Compound Name | [1-[3-(4-iodophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
|---|---|
| PubChem CID | 158141087 |
| Molecular Formula | C30H33BrINO4 |
| Molecular Weight | 678.41 g/mol |
| Exact Mass | 677.06 |
| IUPAC Name | [1-[3-(4-iodophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
| SMILES | O=C(OC1C[N+]2(CCCOc3ccc(I)cc3)CCC1CC2)C(O)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C30H33INO4.BrH/c31-26-12-14-27(15-13-26)35-21-7-18-32-19-16-23(17-20-32)28(22-32)36-29(33)30(34,24-8-3-1-4-9-24)25-10-5-2-6-11-25;/h1-6,8-15,23,28,34H,7,16-22H2;1H/q+1;/p-1 |
| InChIKey | QWLJEHAAHDGPBH-UHFFFAOYSA-M |
| XLogP | 2.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|