C29H39BrN2O3S — CID 68592405
[(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate bromide (PubChem CID 68592405) has the molecular formula C29H39BrN2O3S and a molecular weight of 575.61 g/mol. Its IUPAC name is [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate bromide.
| Compound Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate bromide |
|---|---|
| PubChem CID | 68592405 |
| Molecular Formula | C29H39BrN2O3S |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate bromide |
| SMILES | CC(C(=O)O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)(c1ccccc1)N1CCSCC1.[Br-] |
| InChI | InChI=1S/C29H39N2O3S.BrH/c1-29(25-9-4-2-5-10-25,30-15-21-35-22-16-30)28(32)34-27-23-31(18-13-24(27)14-19-31)17-8-20-33-26-11-6-3-7-12-26;/h2-7,9-12,24,27H,8,13-23H2,1H3;1H/q+1;/p-1/t24?,27-,29?,31?;/m0./s1 |
| InChIKey | RPLYMEKNDYDTQW-JBZQIEGSSA-M |
| XLogP | 1.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|