C29H39N2O2+ — CID 57393503
[(3R)-1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate (PubChem CID 57393503) has the molecular formula C29H39N2O2+ and a molecular weight of 447.64 g/mol. Its IUPAC name is [(3R)-1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate.
| Compound Name | [(3R)-1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 57393503 |
| Molecular Formula | C29H39N2O2+ |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | [(3R)-1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
| SMILES | C[C@@](C(=O)O[C@H]1C[N+]2(CCc3ccccc3)CCC1CC2)(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C29H39N2O2/c1-29(26-13-7-3-8-14-26,30-18-9-4-10-19-30)28(32)33-27-23-31(21-16-25(27)17-22-31)20-15-24-11-5-2-6-12-24/h2-3,5-8,11-14,25,27H,4,9-10,15-23H2,1H3/q+1/t25?,27-,29-,31?/m0/s1 |
| InChIKey | DVEKJMIGSBNUCB-YXWZOGTMSA-N |
| XLogP | 4.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|