C30H40ClN2O2+ — CID 59316242
[(3R)-1-[2-(3-chlorophenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(azepan-1-yl)-2-phenylpropanoate (PubChem CID 59316242) has the molecular formula C30H40ClN2O2+ and a molecular weight of 496.12 g/mol. Its IUPAC name is [(3R)-1-[2-(3-chlorophenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(azepan-1-yl)-2-phenylpropanoate.
| Compound Name | [(3R)-1-[2-(3-chlorophenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(azepan-1-yl)-2-phenylpropanoate |
|---|---|
| PubChem CID | 59316242 |
| Molecular Formula | C30H40ClN2O2+ |
| Molecular Weight | 496.12 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | [(3R)-1-[2-(3-chlorophenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(azepan-1-yl)-2-phenylpropanoate |
| SMILES | CC(C(=O)O[C@H]1C[N+]2(CCc3cccc(Cl)c3)CCC1CC2)(c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C30H40ClN2O2/c1-30(26-11-5-4-6-12-26,32-17-7-2-3-8-18-32)29(34)35-28-23-33(20-15-25(28)16-21-33)19-14-24-10-9-13-27(31)22-24/h4-6,9-13,22,25,28H,2-3,7-8,14-21,23H2,1H3/q+1/t25?,28-,30?,33?/m0/s1 |
| InChIKey | WMWWHRPKFUUOCF-IBGIQVRPSA-N |
| XLogP | 5.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.12 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|