C28H38BrN3O2S — CID 68589146
[(3R)-1-(3-pyridin-3-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate bromide (PubChem CID 68589146) has the molecular formula C28H38BrN3O2S and a molecular weight of 560.60 g/mol. Its IUPAC name is [(3R)-1-(3-pyridin-3-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate bromide.
| Compound Name | [(3R)-1-(3-pyridin-3-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate bromide |
|---|---|
| PubChem CID | 68589146 |
| Molecular Formula | C28H38BrN3O2S |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | [(3R)-1-(3-pyridin-3-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate bromide |
| SMILES | CC(C(=O)O[C@H]1C[N+]2(CCCc3cccnc3)CCC1CC2)(c1ccccc1)N1CCSCC1.[Br-] |
| InChI | InChI=1S/C28H38N3O2S.BrH/c1-28(25-9-3-2-4-10-25,30-14-19-34-20-15-30)27(32)33-26-22-31(17-11-24(26)12-18-31)16-6-8-23-7-5-13-29-21-23;/h2-5,7,9-10,13,21,24,26H,6,8,11-12,14-20,22H2,1H3;1H/q+1;/p-1/t24?,26-,28?,31?;/m0./s1 |
| InChIKey | XSFCVULMOHMNIY-LJLQEPMTSA-M |
| XLogP | 1.13 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|