C27H37BrN2O2S2 — CID 68590769
[(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-thiomorpholin-4-yl-2-thiophen-2-ylpropanoate bromide (PubChem CID 68590769) has the molecular formula C27H37BrN2O2S2 and a molecular weight of 565.64 g/mol. Its IUPAC name is [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-thiomorpholin-4-yl-2-thiophen-2-ylpropanoate bromide.
| Compound Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-thiomorpholin-4-yl-2-thiophen-2-ylpropanoate bromide |
|---|---|
| PubChem CID | 68590769 |
| Molecular Formula | C27H37BrN2O2S2 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-thiomorpholin-4-yl-2-thiophen-2-ylpropanoate bromide |
| SMILES | CC(C(=O)O[C@H]1C[N+]2(CCCc3ccccc3)CCC1CC2)(c1cccs1)N1CCSCC1.[Br-] |
| InChI | InChI=1S/C27H37N2O2S2.BrH/c1-27(25-10-6-18-33-25,28-13-19-32-20-14-28)26(30)31-24-21-29(16-11-23(24)12-17-29)15-5-9-22-7-3-2-4-8-22;/h2-4,6-8,10,18,23-24H,5,9,11-17,19-21H2,1H3;1H/q+1;/p-1/t23?,24-,27?,29?;/m0./s1 |
| InChIKey | CDZJIUBCRBUNRX-RASQNOKMSA-M |
| XLogP | 1.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|