C27H36FN2O2S+ — CID 69094738
[1-[2-(2-fluorophenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate (PubChem CID 69094738) has the molecular formula C27H36FN2O2S+ and a molecular weight of 471.66 g/mol. Its IUPAC name is [1-[2-(2-fluorophenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate.
| Compound Name | [1-[2-(2-fluorophenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 69094738 |
| Molecular Formula | C27H36FN2O2S+ |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | [1-[2-(2-fluorophenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate |
| SMILES | CC(C(=O)OC1C[N+]2(CCc3ccccc3F)CCC1CC2)(c1cccs1)N1CCCCC1 |
| InChI | InChI=1S/C27H36FN2O2S/c1-27(25-10-7-19-33-25,29-14-5-2-6-15-29)26(31)32-24-20-30(17-12-22(24)13-18-30)16-11-21-8-3-4-9-23(21)28/h3-4,7-10,19,22,24H,2,5-6,11-18,20H2,1H3/q+1 |
| InChIKey | RAWSDFNXZQJMDA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|