C24H32NO3S2+ — CID 11410393
[(3R)-1-(cyclohexylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 11410393) has the molecular formula C24H32NO3S2+ and a molecular weight of 446.66 g/mol. Its IUPAC name is [(3R)-1-(cyclohexylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(3R)-1-(cyclohexylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 11410393 |
| Molecular Formula | C24H32NO3S2+ |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [(3R)-1-(cyclohexylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | O=C(O[C@H]1C[N+]2(CC3CCCCC3)CCC1CC2)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C24H32NO3S2/c26-23(24(27,21-8-4-14-29-21)22-9-5-15-30-22)28-20-17-25(12-10-19(20)11-13-25)16-18-6-2-1-3-7-18/h4-5,8-9,14-15,18-20,27H,1-3,6-7,10-13,16-17H2/q+1/t19?,20-,25?/m0/s1 |
| InChIKey | LDOMXEQZIFZLFC-CMAULLTDSA-N |
| XLogP | 4.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|