C22H24N3O5S2+ — CID 86611383
[(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 86611383) has the molecular formula C22H24N3O5S2+ and a molecular weight of 474.58 g/mol. Its IUPAC name is [(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 86611383 |
| Molecular Formula | C22H24N3O5S2+ |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1cccs1)c1cccs1)C2)Nc1ccon1 |
| InChI | InChI=1S/C22H23N3O5S2/c26-20(23-19-7-10-29-24-19)14-25-8-5-15(6-9-25)16(13-25)30-21(27)22(28,17-3-1-11-31-17)18-4-2-12-32-18/h1-4,7,10-12,15-16,28H,5-6,8-9,13-14H2/p+1/t15?,16-,25?/m0/s1 |
| InChIKey | YQKQSZPDKUBZCZ-BUAFLGJXSA-O |
| XLogP | 2.82 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|