C27H28N3O4+ — CID 72992458
[1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9,10-dihydroanthracene-9-carboxylate (PubChem CID 72992458) has the molecular formula C27H28N3O4+ and a molecular weight of 458.54 g/mol. Its IUPAC name is [1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9,10-dihydroanthracene-9-carboxylate.
| Compound Name | [1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9,10-dihydroanthracene-9-carboxylate |
|---|---|
| PubChem CID | 72992458 |
| Molecular Formula | C27H28N3O4+ |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | [1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9,10-dihydroanthracene-9-carboxylate |
| SMILES | O=C(C[N+]12CCC(CC1)C(OC(=O)C1c3ccccc3Cc3ccccc31)C2)Nc1ccon1 |
| InChI | InChI=1S/C27H27N3O4/c31-25(28-24-11-14-33-29-24)17-30-12-9-18(10-13-30)23(16-30)34-27(32)26-21-7-3-1-5-19(21)15-20-6-2-4-8-22(20)26/h1-8,11,14,18,23,26H,9-10,12-13,15-17H2/p+1 |
| InChIKey | HXCMYDUVCXBUIV-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|