C24H25ClNO3S2+ — CID 44545119
[(3R)-1-[(4-chlorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 44545119) has the molecular formula C24H25ClNO3S2+ and a molecular weight of 475.06 g/mol. Its IUPAC name is [(3R)-1-[(4-chlorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(3R)-1-[(4-chlorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 44545119 |
| Molecular Formula | C24H25ClNO3S2+ |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | [(3R)-1-[(4-chlorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | O=C(O[C@H]1C[N+]2(Cc3ccc(Cl)cc3)CCC1CC2)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C24H25ClNO3S2/c25-19-7-5-17(6-8-19)15-26-11-9-18(10-12-26)20(16-26)29-23(27)24(28,21-3-1-13-30-21)22-4-2-14-31-22/h1-8,13-14,18,20,28H,9-12,15-16H2/q+1/t18?,20-,26?/m0/s1 |
| InChIKey | KCHGMWVAICTWMN-FRQRHGNXSA-N |
| XLogP | 5.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|