C27H32NO5S2+ — CID 67269117
[1-[3-[2-(hydroxymethyl)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 67269117) has the molecular formula C27H32NO5S2+ and a molecular weight of 514.69 g/mol. Its IUPAC name is [1-[3-[2-(hydroxymethyl)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [1-[3-[2-(hydroxymethyl)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 67269117 |
| Molecular Formula | C27H32NO5S2+ |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | [1-[3-[2-(hydroxymethyl)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | O=C(OC1C[N+]2(CCCOc3ccccc3CO)CCC1CC2)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C27H32NO5S2/c29-19-21-6-1-2-7-22(21)32-15-5-12-28-13-10-20(11-14-28)23(18-28)33-26(30)27(31,24-8-3-16-34-24)25-9-4-17-35-25/h1-4,6-9,16-17,20,23,29,31H,5,10-15,18-19H2/q+1 |
| InChIKey | WHXAUMHCQPXBFW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|