C26H30NO5S+ — CID 66592414
[(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylacetate (PubChem CID 66592414) has the molecular formula C26H30NO5S+ and a molecular weight of 468.60 g/mol. Its IUPAC name is [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylacetate.
| Compound Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 66592414 |
| Molecular Formula | C26H30NO5S+ |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylacetate |
| SMILES | O=C(O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)C(O)(c1ccco1)c1cccs1 |
| InChI | InChI=1S/C26H30NO5S/c28-25(26(29,23-9-4-16-31-23)24-10-5-18-33-24)32-22-19-27(14-11-20(22)12-15-27)13-6-17-30-21-7-2-1-3-8-21/h1-5,7-10,16,18,20,22,29H,6,11-15,17,19H2/q+1/t20?,22-,26?,27?/m0/s1 |
| InChIKey | IYWRNILAOARDKA-WDVLHWPLSA-N |
| XLogP | 4.20 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|